C19H28F3N5O — CID 111914352
N-ethyl-4-[[[ethylamino-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]amino]methylidene]amino]methyl]benzamide (PubChem CID 111914352) has the molecular formula C19H28F3N5O and a molecular weight of 399.46 g/mol. Its IUPAC name is N-ethyl-4-[[[ethylamino-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]amino]methylidene]amino]methyl]benzamide.
| Compound Name | N-ethyl-4-[[[ethylamino-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]amino]methylidene]amino]methyl]benzamide |
|---|---|
| PubChem CID | 111914352 |
| Molecular Formula | C19H28F3N5O |
| Molecular Weight | 399.46 g/mol |
| Exact Mass | 399.22 |
| IUPAC Name | N-ethyl-4-[[[ethylamino-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]amino]methylidene]amino]methyl]benzamide |
| SMILES | CCNC(=O)c1ccc(C/N=C(\NCC)NC2CCN(CC(F)(F)F)C2)cc1 |
| InChI | InChI=1S/C19H28F3N5O/c1-3-23-17(28)15-7-5-14(6-8-15)11-25-18(24-4-2)26-16-9-10-27(12-16)13-19(20,21)22/h5-8,16H,3-4,9-13H2,1-2H3,(H,23,28)(H2,24,25,26) |
| InChIKey | QCJDACQVATZNTB-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.46 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|