C22H32F3N5O — CID 111914432
1-ethyl-2-[[4-(piperidine-1-carbonyl)phenyl]methyl]-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine (PubChem CID 111914432) has the molecular formula C22H32F3N5O and a molecular weight of 439.53 g/mol. Its IUPAC name is 1-ethyl-2-[[4-(piperidine-1-carbonyl)phenyl]methyl]-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine.
| Compound Name | 1-ethyl-2-[[4-(piperidine-1-carbonyl)phenyl]methyl]-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine |
|---|---|
| PubChem CID | 111914432 |
| Molecular Formula | C22H32F3N5O |
| Molecular Weight | 439.53 g/mol |
| Exact Mass | 439.26 |
| IUPAC Name | 1-ethyl-2-[[4-(piperidine-1-carbonyl)phenyl]methyl]-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine |
| SMILES | CCN/C(=N\Cc1ccc(C(=O)N2CCCCC2)cc1)NC1CCN(CC(F)(F)F)C1 |
| InChI | InChI=1S/C22H32F3N5O/c1-2-26-21(28-19-10-13-29(15-19)16-22(23,24)25)27-14-17-6-8-18(9-7-17)20(31)30-11-4-3-5-12-30/h6-9,19H,2-5,10-16H2,1H3,(H2,26,27,28) |
| InChIKey | YBEHIFVPUUAYGX-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.53 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|