C18H28F3N5O2S — CID 111914118
2-[[4-(dimethylsulfamoyl)phenyl]methyl]-1-ethyl-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine (PubChem CID 111914118) has the molecular formula C18H28F3N5O2S and a molecular weight of 435.52 g/mol. Its IUPAC name is 2-[[4-(dimethylsulfamoyl)phenyl]methyl]-1-ethyl-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine.
| Compound Name | 2-[[4-(dimethylsulfamoyl)phenyl]methyl]-1-ethyl-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine |
|---|---|
| PubChem CID | 111914118 |
| Molecular Formula | C18H28F3N5O2S |
| Molecular Weight | 435.52 g/mol |
| Exact Mass | 435.19 |
| IUPAC Name | 2-[[4-(dimethylsulfamoyl)phenyl]methyl]-1-ethyl-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine |
| SMILES | CCN/C(=N\Cc1ccc(S(=O)(=O)N(C)C)cc1)NC1CCN(CC(F)(F)F)C1 |
| InChI | InChI=1S/C18H28F3N5O2S/c1-4-22-17(24-15-9-10-26(12-15)13-18(19,20)21)23-11-14-5-7-16(8-6-14)29(27,28)25(2)3/h5-8,15H,4,9-13H2,1-3H3,(H2,22,23,24) |
| InChIKey | VXNZLTSYTXTZHP-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 77.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.52 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|