C24H34IN5O — CID 111908862
3-[[[ethylamino-[(1-phenylpyrrolidin-3-yl)amino]methylidene]amino]methyl]-N-propylbenzamide;hydroiodide (PubChem CID 111908862) has the molecular formula C24H34IN5O and a molecular weight of 535.47 g/mol. Its IUPAC name is 3-[[[ethylamino-[(1-phenylpyrrolidin-3-yl)amino]methylidene]amino]methyl]-N-propylbenzamide;hydroiodide.
| Compound Name | 3-[[[ethylamino-[(1-phenylpyrrolidin-3-yl)amino]methylidene]amino]methyl]-N-propylbenzamide;hydroiodide |
|---|---|
| PubChem CID | 111908862 |
| Molecular Formula | C24H34IN5O |
| Molecular Weight | 535.47 g/mol |
| Exact Mass | 535.18 |
| IUPAC Name | 3-[[[ethylamino-[(1-phenylpyrrolidin-3-yl)amino]methylidene]amino]methyl]-N-propylbenzamide;hydroiodide |
| SMILES | CCCNC(=O)c1cccc(C/N=C(\NCC)NC2CCN(c3ccccc3)C2)c1.I |
| InChI | InChI=1S/C24H33N5O.HI/c1-3-14-26-23(30)20-10-8-9-19(16-20)17-27-24(25-4-2)28-21-13-15-29(18-21)22-11-6-5-7-12-22;/h5-12,16,21H,3-4,13-15,17-18H2,1-2H3,(H,26,30)(H2,25,27,28);1H |
| InChIKey | RTWTWFSOTQFZSM-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.47 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|