C21H36IN5O2S — CID 109439054
2-(dimethylamino)-N-[3-[[[N-(3-ethylsulfinylcyclohexyl)-N'-methylcarbamimidoyl]amino]methyl]phenyl]acetamide;hydroiodide (PubChem CID 109439054) has the molecular formula C21H36IN5O2S and a molecular weight of 549.52 g/mol. Its IUPAC name is 2-(dimethylamino)-N-[3-[[[N-(3-ethylsulfinylcyclohexyl)-N'-methylcarbamimidoyl]amino]methyl]phenyl]acetamide;hydroiodide.
| Compound Name | 2-(dimethylamino)-N-[3-[[[N-(3-ethylsulfinylcyclohexyl)-N'-methylcarbamimidoyl]amino]methyl]phenyl]acetamide;hydroiodide |
|---|---|
| PubChem CID | 109439054 |
| Molecular Formula | C21H36IN5O2S |
| Molecular Weight | 549.52 g/mol |
| Exact Mass | 549.16 |
| IUPAC Name | 2-(dimethylamino)-N-[3-[[[N-(3-ethylsulfinylcyclohexyl)-N'-methylcarbamimidoyl]amino]methyl]phenyl]acetamide;hydroiodide |
| SMILES | CCS(=O)C1CCCC(N/C(=N/C)NCc2cccc(NC(=O)CN(C)C)c2)C1.I |
| InChI | InChI=1S/C21H35N5O2S.HI/c1-5-29(28)19-11-7-10-18(13-19)25-21(22-2)23-14-16-8-6-9-17(12-16)24-20(27)15-26(3)4;/h6,8-9,12,18-19H,5,7,10-11,13-15H2,1-4H3,(H,24,27)(H2,22,23,25);1H |
| InChIKey | HCDNKRKVIUEWSS-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.52 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|