C21H36N6O — CID 111017303
2-(dimethylamino)-N-[3-[[[N'-methyl-N-(1-propylpiperidin-4-yl)carbamimidoyl]amino]methyl]phenyl]acetamide (PubChem CID 111017303) has the molecular formula C21H36N6O and a molecular weight of 388.56 g/mol. Its IUPAC name is 2-(dimethylamino)-N-[3-[[[N'-methyl-N-(1-propylpiperidin-4-yl)carbamimidoyl]amino]methyl]phenyl]acetamide.
| Compound Name | 2-(dimethylamino)-N-[3-[[[N'-methyl-N-(1-propylpiperidin-4-yl)carbamimidoyl]amino]methyl]phenyl]acetamide |
|---|---|
| PubChem CID | 111017303 |
| Molecular Formula | C21H36N6O |
| Molecular Weight | 388.56 g/mol |
| Exact Mass | 388.30 |
| IUPAC Name | 2-(dimethylamino)-N-[3-[[[N'-methyl-N-(1-propylpiperidin-4-yl)carbamimidoyl]amino]methyl]phenyl]acetamide |
| SMILES | CCCN1CCC(N/C(=N/C)NCc2cccc(NC(=O)CN(C)C)c2)CC1 |
| InChI | InChI=1S/C21H36N6O/c1-5-11-27-12-9-18(10-13-27)25-21(22-2)23-15-17-7-6-8-19(14-17)24-20(28)16-26(3)4/h6-8,14,18H,5,9-13,15-16H2,1-4H3,(H,24,28)(H2,22,23,25) |
| InChIKey | HPQCFRZTGAXSDA-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 72.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.56 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|