C22H39IN6O — CID 111568050
2-(dimethylamino)-N-[3-[[[N-[2-(2-ethylpiperidin-1-yl)ethyl]-N'-methylcarbamimidoyl]amino]methyl]phenyl]acetamide;hydroiodide (PubChem CID 111568050) has the molecular formula C22H39IN6O and a molecular weight of 530.50 g/mol. Its IUPAC name is 2-(dimethylamino)-N-[3-[[[N-[2-(2-ethylpiperidin-1-yl)ethyl]-N'-methylcarbamimidoyl]amino]methyl]phenyl]acetamide;hydroiodide.
| Compound Name | 2-(dimethylamino)-N-[3-[[[N-[2-(2-ethylpiperidin-1-yl)ethyl]-N'-methylcarbamimidoyl]amino]methyl]phenyl]acetamide;hydroiodide |
|---|---|
| PubChem CID | 111568050 |
| Molecular Formula | C22H39IN6O |
| Molecular Weight | 530.50 g/mol |
| Exact Mass | 530.22 |
| IUPAC Name | 2-(dimethylamino)-N-[3-[[[N-[2-(2-ethylpiperidin-1-yl)ethyl]-N'-methylcarbamimidoyl]amino]methyl]phenyl]acetamide;hydroiodide |
| SMILES | CCC1CCCCN1CCN/C(=N\C)NCc1cccc(NC(=O)CN(C)C)c1.I |
| InChI | InChI=1S/C22H38N6O.HI/c1-5-20-11-6-7-13-28(20)14-12-24-22(23-2)25-16-18-9-8-10-19(15-18)26-21(29)17-27(3)4;/h8-10,15,20H,5-7,11-14,16-17H2,1-4H3,(H,26,29)(H2,23,24,25);1H |
| InChIKey | GMSRDZXSXDFOQE-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 72.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.50 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|