C20H36IN5 — CID 111568758
1-[[3-(dimethylamino)phenyl]methyl]-3-[2-(2-ethylpiperidin-1-yl)ethyl]-2-methylguanidine;hydroiodide (PubChem CID 111568758) has the molecular formula C20H36IN5 and a molecular weight of 473.45 g/mol. Its IUPAC name is 1-[[3-(dimethylamino)phenyl]methyl]-3-[2-(2-ethylpiperidin-1-yl)ethyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[[3-(dimethylamino)phenyl]methyl]-3-[2-(2-ethylpiperidin-1-yl)ethyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111568758 |
| Molecular Formula | C20H36IN5 |
| Molecular Weight | 473.45 g/mol |
| Exact Mass | 473.20 |
| IUPAC Name | 1-[[3-(dimethylamino)phenyl]methyl]-3-[2-(2-ethylpiperidin-1-yl)ethyl]-2-methylguanidine;hydroiodide |
| SMILES | CCC1CCCCN1CCN/C(=N\C)NCc1cccc(N(C)C)c1.I |
| InChI | InChI=1S/C20H35N5.HI/c1-5-18-10-6-7-13-25(18)14-12-22-20(21-2)23-16-17-9-8-11-19(15-17)24(3)4;/h8-9,11,15,18H,5-7,10,12-14,16H2,1-4H3,(H2,21,22,23);1H |
| InChIKey | YQOUTJNAEIFWRF-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 42.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.45 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|