C21H29F2N5O — CID 111920915
1-[1-(2,4-difluorophenyl)pyrrolidin-3-yl]-2-[2-(dimethylamino)-2-(furan-2-yl)ethyl]-3-ethylguanidine (PubChem CID 111920915) has the molecular formula C21H29F2N5O and a molecular weight of 405.49 g/mol. Its IUPAC name is 1-[1-(2,4-difluorophenyl)pyrrolidin-3-yl]-2-[2-(dimethylamino)-2-(furan-2-yl)ethyl]-3-ethylguanidine.
| Compound Name | 1-[1-(2,4-difluorophenyl)pyrrolidin-3-yl]-2-[2-(dimethylamino)-2-(furan-2-yl)ethyl]-3-ethylguanidine |
|---|---|
| PubChem CID | 111920915 |
| Molecular Formula | C21H29F2N5O |
| Molecular Weight | 405.49 g/mol |
| Exact Mass | 405.23 |
| IUPAC Name | 1-[1-(2,4-difluorophenyl)pyrrolidin-3-yl]-2-[2-(dimethylamino)-2-(furan-2-yl)ethyl]-3-ethylguanidine |
| SMILES | CCN/C(=N\CC(c1ccco1)N(C)C)NC1CCN(c2ccc(F)cc2F)C1 |
| InChI | InChI=1S/C21H29F2N5O/c1-4-24-21(25-13-19(27(2)3)20-6-5-11-29-20)26-16-9-10-28(14-16)18-8-7-15(22)12-17(18)23/h5-8,11-12,16,19H,4,9-10,13-14H2,1-3H3,(H2,24,25,26) |
| InChIKey | JOQBJOLIUKBORW-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 56.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.49 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|