C22H32F2IN5O2 — CID 111921872
1-[1-[2-(difluoromethoxy)phenyl]pyrrolidin-3-yl]-2-[2-(dimethylamino)-2-(furan-2-yl)ethyl]-3-ethylguanidine;hydroiodide (PubChem CID 111921872) has the molecular formula C22H32F2IN5O2 and a molecular weight of 563.43 g/mol. Its IUPAC name is 1-[1-[2-(difluoromethoxy)phenyl]pyrrolidin-3-yl]-2-[2-(dimethylamino)-2-(furan-2-yl)ethyl]-3-ethylguanidine;hydroiodide.
| Compound Name | 1-[1-[2-(difluoromethoxy)phenyl]pyrrolidin-3-yl]-2-[2-(dimethylamino)-2-(furan-2-yl)ethyl]-3-ethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111921872 |
| Molecular Formula | C22H32F2IN5O2 |
| Molecular Weight | 563.43 g/mol |
| Exact Mass | 563.16 |
| IUPAC Name | 1-[1-[2-(difluoromethoxy)phenyl]pyrrolidin-3-yl]-2-[2-(dimethylamino)-2-(furan-2-yl)ethyl]-3-ethylguanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(c1ccco1)N(C)C)NC1CCN(c2ccccc2OC(F)F)C1.I |
| InChI | InChI=1S/C22H31F2N5O2.HI/c1-4-25-22(26-14-18(28(2)3)19-10-7-13-30-19)27-16-11-12-29(15-16)17-8-5-6-9-20(17)31-21(23)24;/h5-10,13,16,18,21H,4,11-12,14-15H2,1-3H3,(H2,25,26,27);1H |
| InChIKey | JSHIIPLHQXNVGT-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 65.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.43 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|