C22H34ClN5O2 — CID 111917555
2-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-1-[1-(5-chloro-2-methoxyphenyl)pyrrolidin-3-yl]-3-ethylguanidine (PubChem CID 111917555) has the molecular formula C22H34ClN5O2 and a molecular weight of 436.00 g/mol. Its IUPAC name is 2-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-1-[1-(5-chloro-2-methoxyphenyl)pyrrolidin-3-yl]-3-ethylguanidine.
| Compound Name | 2-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-1-[1-(5-chloro-2-methoxyphenyl)pyrrolidin-3-yl]-3-ethylguanidine |
|---|---|
| PubChem CID | 111917555 |
| Molecular Formula | C22H34ClN5O2 |
| Molecular Weight | 436.00 g/mol |
| Exact Mass | 435.24 |
| IUPAC Name | 2-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-1-[1-(5-chloro-2-methoxyphenyl)pyrrolidin-3-yl]-3-ethylguanidine |
| SMILES | CCN/C(=N\CC1CN2CCCC2CO1)NC1CCN(c2cc(Cl)ccc2OC)C1 |
| InChI | InChI=1S/C22H34ClN5O2/c1-3-24-22(25-12-19-14-27-9-4-5-18(27)15-30-19)26-17-8-10-28(13-17)20-11-16(23)6-7-21(20)29-2/h6-7,11,17-19H,3-5,8-10,12-15H2,1-2H3,(H2,24,25,26) |
| InChIKey | FTJALJNLEVWCHC-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.00 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|