C22H38ClIN6O — CID 111917092
1-[1-(5-chloro-2-methoxyphenyl)pyrrolidin-3-yl]-3-ethyl-2-[2-(4-methylpiperazin-1-yl)propyl]guanidine;hydroiodide (PubChem CID 111917092) has the molecular formula C22H38ClIN6O and a molecular weight of 564.94 g/mol. Its IUPAC name is 1-[1-(5-chloro-2-methoxyphenyl)pyrrolidin-3-yl]-3-ethyl-2-[2-(4-methylpiperazin-1-yl)propyl]guanidine;hydroiodide.
| Compound Name | 1-[1-(5-chloro-2-methoxyphenyl)pyrrolidin-3-yl]-3-ethyl-2-[2-(4-methylpiperazin-1-yl)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111917092 |
| Molecular Formula | C22H38ClIN6O |
| Molecular Weight | 564.94 g/mol |
| Exact Mass | 564.18 |
| IUPAC Name | 1-[1-(5-chloro-2-methoxyphenyl)pyrrolidin-3-yl]-3-ethyl-2-[2-(4-methylpiperazin-1-yl)propyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(C)N1CCN(C)CC1)NC1CCN(c2cc(Cl)ccc2OC)C1.I |
| InChI | InChI=1S/C22H37ClN6O.HI/c1-5-24-22(25-15-17(2)28-12-10-27(3)11-13-28)26-19-8-9-29(16-19)20-14-18(23)6-7-21(20)30-4;/h6-7,14,17,19H,5,8-13,15-16H2,1-4H3,(H2,24,25,26);1H |
| InChIKey | NVQJNOATQFXCCS-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 55.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.94 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|