C22H37ClN6O — CID 111917501
1-[1-(5-chloro-2-methoxyphenyl)pyrrolidin-3-yl]-2-methyl-3-[2-methyl-3-(4-methylpiperazin-1-yl)propyl]guanidine (PubChem CID 111917501) has the molecular formula C22H37ClN6O and a molecular weight of 437.03 g/mol. Its IUPAC name is 1-[1-(5-chloro-2-methoxyphenyl)pyrrolidin-3-yl]-2-methyl-3-[2-methyl-3-(4-methylpiperazin-1-yl)propyl]guanidine.
| Compound Name | 1-[1-(5-chloro-2-methoxyphenyl)pyrrolidin-3-yl]-2-methyl-3-[2-methyl-3-(4-methylpiperazin-1-yl)propyl]guanidine |
|---|---|
| PubChem CID | 111917501 |
| Molecular Formula | C22H37ClN6O |
| Molecular Weight | 437.03 g/mol |
| Exact Mass | 436.27 |
| IUPAC Name | 1-[1-(5-chloro-2-methoxyphenyl)pyrrolidin-3-yl]-2-methyl-3-[2-methyl-3-(4-methylpiperazin-1-yl)propyl]guanidine |
| SMILES | C/N=C(\NCC(C)CN1CCN(C)CC1)NC1CCN(c2cc(Cl)ccc2OC)C1 |
| InChI | InChI=1S/C22H37ClN6O/c1-17(15-28-11-9-27(3)10-12-28)14-25-22(24-2)26-19-7-8-29(16-19)20-13-18(23)5-6-21(20)30-4/h5-6,13,17,19H,7-12,14-16H2,1-4H3,(H2,24,25,26) |
| InChIKey | DFVGUBJFTJPHPV-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 55.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.03 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|