C18H25F2IN6O — CID 111865245
1-[[2-(difluoromethoxy)phenyl]methyl]-2-methyl-3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethyl)guanidine;hydroiodide (PubChem CID 111865245) has the molecular formula C18H25F2IN6O and a molecular weight of 506.34 g/mol. Its IUPAC name is 1-[[2-(difluoromethoxy)phenyl]methyl]-2-methyl-3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethyl)guanidine;hydroiodide.
| Compound Name | 1-[[2-(difluoromethoxy)phenyl]methyl]-2-methyl-3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111865245 |
| Molecular Formula | C18H25F2IN6O |
| Molecular Weight | 506.34 g/mol |
| Exact Mass | 506.11 |
| IUPAC Name | 1-[[2-(difluoromethoxy)phenyl]methyl]-2-methyl-3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethyl)guanidine;hydroiodide |
| SMILES | C/N=C(\NCc1ccccc1OC(F)F)NCc1nnc2n1CCCCC2.I |
| InChI | InChI=1S/C18H24F2N6O.HI/c1-21-18(22-11-13-7-4-5-8-14(13)27-17(19)20)23-12-16-25-24-15-9-3-2-6-10-26(15)16;/h4-5,7-8,17H,2-3,6,9-12H2,1H3,(H2,21,22,23);1H |
| InChIKey | SJLVOCNNGDKENS-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 76.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.34 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|