C15H23N3S — CID 111112058
1,2-dimethyl-3-[(1-phenylsulfanylcyclopentyl)methyl]guanidine (PubChem CID 111112058) has the molecular formula C15H23N3S and a molecular weight of 277.44 g/mol. Its IUPAC name is 1,2-dimethyl-3-[(1-phenylsulfanylcyclopentyl)methyl]guanidine.
| Compound Name | 1,2-dimethyl-3-[(1-phenylsulfanylcyclopentyl)methyl]guanidine |
|---|---|
| PubChem CID | 111112058 |
| Molecular Formula | C15H23N3S |
| Molecular Weight | 277.44 g/mol |
| Exact Mass | 277.16 |
| IUPAC Name | 1,2-dimethyl-3-[(1-phenylsulfanylcyclopentyl)methyl]guanidine |
| SMILES | C/N=C(\NC)NCC1(Sc2ccccc2)CCCC1 |
| InChI | InChI=1S/C15H23N3S/c1-16-14(17-2)18-12-15(10-6-7-11-15)19-13-8-4-3-5-9-13/h3-5,8-9H,6-7,10-12H2,1-2H3,(H2,16,17,18) |
| InChIKey | IWXRQSRRNHEZQC-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.44 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|