C21H31IN6O2 — CID 111280298
1-[3-(3,5-dimethylpyrazol-1-yl)propyl]-2-methyl-3-[2-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]ethyl]guanidine;hydroiodide (PubChem CID 111280298) has the molecular formula C21H31IN6O2 and a molecular weight of 526.42 g/mol. Its IUPAC name is 1-[3-(3,5-dimethylpyrazol-1-yl)propyl]-2-methyl-3-[2-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]ethyl]guanidine;hydroiodide.
| Compound Name | 1-[3-(3,5-dimethylpyrazol-1-yl)propyl]-2-methyl-3-[2-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111280298 |
| Molecular Formula | C21H31IN6O2 |
| Molecular Weight | 526.42 g/mol |
| Exact Mass | 526.16 |
| IUPAC Name | 1-[3-(3,5-dimethylpyrazol-1-yl)propyl]-2-methyl-3-[2-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]ethyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCCCn1nc(C)cc1C)NCCOc1ccc2c(c1)CCC(=O)N2.I |
| InChI | InChI=1S/C21H30N6O2.HI/c1-15-13-16(2)27(26-15)11-4-9-23-21(22-3)24-10-12-29-18-6-7-19-17(14-18)5-8-20(28)25-19;/h6-7,13-14H,4-5,8-12H2,1-3H3,(H,25,28)(H2,22,23,24);1H |
| InChIKey | WETBIWQLWMCARN-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 92.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.42 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|