C25H34IN5O2 — CID 111583761
1-[(1-benzylpyrrolidin-2-yl)methyl]-2-methyl-3-[2-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]ethyl]guanidine;hydroiodide (PubChem CID 111583761) has the molecular formula C25H34IN5O2 and a molecular weight of 563.48 g/mol. Its IUPAC name is 1-[(1-benzylpyrrolidin-2-yl)methyl]-2-methyl-3-[2-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]ethyl]guanidine;hydroiodide.
| Compound Name | 1-[(1-benzylpyrrolidin-2-yl)methyl]-2-methyl-3-[2-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111583761 |
| Molecular Formula | C25H34IN5O2 |
| Molecular Weight | 563.48 g/mol |
| Exact Mass | 563.18 |
| IUPAC Name | 1-[(1-benzylpyrrolidin-2-yl)methyl]-2-methyl-3-[2-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]ethyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCCOc1ccc2c(c1)CCC(=O)N2)NCC1CCCN1Cc1ccccc1.I |
| InChI | InChI=1S/C25H33N5O2.HI/c1-26-25(28-17-21-8-5-14-30(21)18-19-6-3-2-4-7-19)27-13-15-32-22-10-11-23-20(16-22)9-12-24(31)29-23;/h2-4,6-7,10-11,16,21H,5,8-9,12-15,17-18H2,1H3,(H,29,31)(H2,26,27,28);1H |
| InChIKey | YJFFNKIFCPYLPS-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 77.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.48 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|