C23H21FN2O5 — CID 78891960
5-[(4-fluorophenoxy)methyl]-N-[2-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]ethyl]furan-2-carboxamide (PubChem CID 78891960) has the molecular formula C23H21FN2O5 and a molecular weight of 424.43 g/mol. Its IUPAC name is 5-[(4-fluorophenoxy)methyl]-N-[2-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]ethyl]furan-2-carboxamide.
| Compound Name | 5-[(4-fluorophenoxy)methyl]-N-[2-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]ethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 78891960 |
| Molecular Formula | C23H21FN2O5 |
| Molecular Weight | 424.43 g/mol |
| Exact Mass | 424.14 |
| IUPAC Name | 5-[(4-fluorophenoxy)methyl]-N-[2-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]ethyl]furan-2-carboxamide |
| SMILES | O=C1CCc2cc(OCCNC(=O)c3ccc(COc4ccc(F)cc4)o3)ccc2N1 |
| InChI | InChI=1S/C23H21FN2O5/c24-16-2-4-17(5-3-16)30-14-19-7-9-21(31-19)23(28)25-11-12-29-18-6-8-20-15(13-18)1-10-22(27)26-20/h2-9,13H,1,10-12,14H2,(H,25,28)(H,26,27) |
| InChIKey | BYTYJJYOEFGJHD-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 89.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.43 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|