C18H16BrFN2O3 — CID 78891632
3-bromo-5-fluoro-N-[2-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]ethyl]benzamide (PubChem CID 78891632) has the molecular formula C18H16BrFN2O3 and a molecular weight of 407.24 g/mol. Its IUPAC name is 3-bromo-5-fluoro-N-[2-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]ethyl]benzamide.
| Compound Name | 3-bromo-5-fluoro-N-[2-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]ethyl]benzamide |
|---|---|
| PubChem CID | 78891632 |
| Molecular Formula | C18H16BrFN2O3 |
| Molecular Weight | 407.24 g/mol |
| Exact Mass | 406.03 |
| IUPAC Name | 3-bromo-5-fluoro-N-[2-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]ethyl]benzamide |
| SMILES | O=C1CCc2cc(OCCNC(=O)c3cc(F)cc(Br)c3)ccc2N1 |
| InChI | InChI=1S/C18H16BrFN2O3/c19-13-7-12(8-14(20)10-13)18(24)21-5-6-25-15-2-3-16-11(9-15)1-4-17(23)22-16/h2-3,7-10H,1,4-6H2,(H,21,24)(H,22,23) |
| InChIKey | FTESDSKKVAGEPB-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.24 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|