C23H23FN4O3 — CID 78902280
1-(4-fluorophenyl)-3,5-dimethyl-N-[2-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]ethyl]pyrazole-4-carboxamide (PubChem CID 78902280) has the molecular formula C23H23FN4O3 and a molecular weight of 422.46 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-3,5-dimethyl-N-[2-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]ethyl]pyrazole-4-carboxamide.
| Compound Name | 1-(4-fluorophenyl)-3,5-dimethyl-N-[2-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]ethyl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 78902280 |
| Molecular Formula | C23H23FN4O3 |
| Molecular Weight | 422.46 g/mol |
| Exact Mass | 422.18 |
| IUPAC Name | 1-(4-fluorophenyl)-3,5-dimethyl-N-[2-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]ethyl]pyrazole-4-carboxamide |
| SMILES | Cc1nn(-c2ccc(F)cc2)c(C)c1C(=O)NCCOc1ccc2c(c1)CCC(=O)N2 |
| InChI | InChI=1S/C23H23FN4O3/c1-14-22(15(2)28(27-14)18-6-4-17(24)5-7-18)23(30)25-11-12-31-19-8-9-20-16(13-19)3-10-21(29)26-20/h4-9,13H,3,10-12H2,1-2H3,(H,25,30)(H,26,29) |
| InChIKey | RDMKBUHCWPBZLB-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.46 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|