C19H18F3N3O3 — CID 78892140
2-methyl-N-[2-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]ethyl]-6-(trifluoromethyl)pyridine-3-carboxamide (PubChem CID 78892140) has the molecular formula C19H18F3N3O3 and a molecular weight of 393.37 g/mol. Its IUPAC name is 2-methyl-N-[2-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]ethyl]-6-(trifluoromethyl)pyridine-3-carboxamide.
| Compound Name | 2-methyl-N-[2-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]ethyl]-6-(trifluoromethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 78892140 |
| Molecular Formula | C19H18F3N3O3 |
| Molecular Weight | 393.37 g/mol |
| Exact Mass | 393.13 |
| IUPAC Name | 2-methyl-N-[2-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]ethyl]-6-(trifluoromethyl)pyridine-3-carboxamide |
| SMILES | Cc1nc(C(F)(F)F)ccc1C(=O)NCCOc1ccc2c(c1)CCC(=O)N2 |
| InChI | InChI=1S/C19H18F3N3O3/c1-11-14(4-6-16(24-11)19(20,21)22)18(27)23-8-9-28-13-3-5-15-12(10-13)2-7-17(26)25-15/h3-6,10H,2,7-9H2,1H3,(H,23,27)(H,25,26) |
| InChIKey | PIGWMYJNVQOIGN-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.37 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|