C23H28N2O4 — CID 78891688
N-[2-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]ethyl]-4-pentoxybenzamide (PubChem CID 78891688) has the molecular formula C23H28N2O4 and a molecular weight of 396.49 g/mol. Its IUPAC name is N-[2-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]ethyl]-4-pentoxybenzamide.
| Compound Name | N-[2-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]ethyl]-4-pentoxybenzamide |
|---|---|
| PubChem CID | 78891688 |
| Molecular Formula | C23H28N2O4 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.20 |
| IUPAC Name | N-[2-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]ethyl]-4-pentoxybenzamide |
| SMILES | CCCCCOc1ccc(C(=O)NCCOc2ccc3c(c2)CCC(=O)N3)cc1 |
| InChI | InChI=1S/C23H28N2O4/c1-2-3-4-14-28-19-8-5-17(6-9-19)23(27)24-13-15-29-20-10-11-21-18(16-20)7-12-22(26)25-21/h5-6,8-11,16H,2-4,7,12-15H2,1H3,(H,24,27)(H,25,26) |
| InChIKey | BKYUKSNCDAASNX-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|