C20H22N2O4 — CID 108784577
N-[2-(4-methoxyphenoxy)ethyl]-2-oxo-1,3,4,5-tetrahydro-1-benzazepine-7-carboxamide (PubChem CID 108784577) has the molecular formula C20H22N2O4 and a molecular weight of 354.41 g/mol. Its IUPAC name is N-[2-(4-methoxyphenoxy)ethyl]-2-oxo-1,3,4,5-tetrahydro-1-benzazepine-7-carboxamide.
| Compound Name | N-[2-(4-methoxyphenoxy)ethyl]-2-oxo-1,3,4,5-tetrahydro-1-benzazepine-7-carboxamide |
|---|---|
| PubChem CID | 108784577 |
| Molecular Formula | C20H22N2O4 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | N-[2-(4-methoxyphenoxy)ethyl]-2-oxo-1,3,4,5-tetrahydro-1-benzazepine-7-carboxamide |
| SMILES | COc1ccc(OCCNC(=O)c2ccc3c(c2)CCCC(=O)N3)cc1 |
| InChI | InChI=1S/C20H22N2O4/c1-25-16-6-8-17(9-7-16)26-12-11-21-20(24)15-5-10-18-14(13-15)3-2-4-19(23)22-18/h5-10,13H,2-4,11-12H2,1H3,(H,21,24)(H,22,23) |
| InChIKey | ONZQHDQXFXSCOJ-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|