C16H25IN4O2 — CID 111057765
2-butyl-1-[2-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]ethyl]guanidine;hydroiodide (PubChem CID 111057765) has the molecular formula C16H25IN4O2 and a molecular weight of 432.31 g/mol. Its IUPAC name is 2-butyl-1-[2-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]ethyl]guanidine;hydroiodide.
| Compound Name | 2-butyl-1-[2-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111057765 |
| Molecular Formula | C16H25IN4O2 |
| Molecular Weight | 432.31 g/mol |
| Exact Mass | 432.10 |
| IUPAC Name | 2-butyl-1-[2-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]ethyl]guanidine;hydroiodide |
| SMILES | CCCC/N=C(\N)NCCOc1ccc2c(c1)CCC(=O)N2.I |
| InChI | InChI=1S/C16H24N4O2.HI/c1-2-3-8-18-16(17)19-9-10-22-13-5-6-14-12(11-13)4-7-15(21)20-14;/h5-6,11H,2-4,7-10H2,1H3,(H,20,21)(H3,17,18,19);1H |
| InChIKey | LRJYZNBQUKEQRZ-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 88.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.31 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|