C19H24N2O5 — CID 119166685
1-[4-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]butanoyl]piperidine-4-carboxylic acid (PubChem CID 119166685) has the molecular formula C19H24N2O5 and a molecular weight of 360.41 g/mol. Its IUPAC name is 1-[4-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]butanoyl]piperidine-4-carboxylic acid.
| Compound Name | 1-[4-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]butanoyl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 119166685 |
| Molecular Formula | C19H24N2O5 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.17 |
| IUPAC Name | 1-[4-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]butanoyl]piperidine-4-carboxylic acid |
| SMILES | O=C1CCc2cc(OCCCC(=O)N3CCC(C(=O)O)CC3)ccc2N1 |
| InChI | InChI=1S/C19H24N2O5/c22-17-6-3-14-12-15(4-5-16(14)20-17)26-11-1-2-18(23)21-9-7-13(8-10-21)19(24)25/h4-5,12-13H,1-3,6-11H2,(H,20,22)(H,24,25) |
| InChIKey | MFGIEGAWKYANJG-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|