C21H22N6O3S — CID 55609152
N-[3-(5-methylsulfanyltetrazol-1-yl)phenyl]-4-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]butanamide (PubChem CID 55609152) has the molecular formula C21H22N6O3S and a molecular weight of 438.51 g/mol. Its IUPAC name is N-[3-(5-methylsulfanyltetrazol-1-yl)phenyl]-4-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]butanamide.
| Compound Name | N-[3-(5-methylsulfanyltetrazol-1-yl)phenyl]-4-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]butanamide |
|---|---|
| PubChem CID | 55609152 |
| Molecular Formula | C21H22N6O3S |
| Molecular Weight | 438.51 g/mol |
| Exact Mass | 438.15 |
| IUPAC Name | N-[3-(5-methylsulfanyltetrazol-1-yl)phenyl]-4-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]butanamide |
| SMILES | CSc1nnnn1-c1cccc(NC(=O)CCCOc2ccc3c(c2)CCC(=O)N3)c1 |
| InChI | InChI=1S/C21H22N6O3S/c1-31-21-24-25-26-27(21)16-5-2-4-15(13-16)22-19(28)6-3-11-30-17-8-9-18-14(12-17)7-10-20(29)23-18/h2,4-5,8-9,12-13H,3,6-7,10-11H2,1H3,(H,22,28)(H,23,29) |
| InChIKey | VQYDSXSSMNFYMR-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 111.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.51 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|