C20H19F3N2O3S — CID 78889333
4-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]-N-[2-(trifluoromethylsulfanyl)phenyl]butanamide (PubChem CID 78889333) has the molecular formula C20H19F3N2O3S and a molecular weight of 424.44 g/mol. Its IUPAC name is 4-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]-N-[2-(trifluoromethylsulfanyl)phenyl]butanamide.
| Compound Name | 4-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]-N-[2-(trifluoromethylsulfanyl)phenyl]butanamide |
|---|---|
| PubChem CID | 78889333 |
| Molecular Formula | C20H19F3N2O3S |
| Molecular Weight | 424.44 g/mol |
| Exact Mass | 424.11 |
| IUPAC Name | 4-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]-N-[2-(trifluoromethylsulfanyl)phenyl]butanamide |
| SMILES | O=C1CCc2cc(OCCCC(=O)Nc3ccccc3SC(F)(F)F)ccc2N1 |
| InChI | InChI=1S/C20H19F3N2O3S/c21-20(22,23)29-17-5-2-1-4-16(17)25-18(26)6-3-11-28-14-8-9-15-13(12-14)7-10-19(27)24-15/h1-2,4-5,8-9,12H,3,6-7,10-11H2,(H,24,27)(H,25,26) |
| InChIKey | LELDHCWPBMEPJJ-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.44 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|