C21H23F3N4O3 — CID 55970686
4-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]-N-[2-[[3-(trifluoromethyl)-2-pyridinyl]amino]ethyl]butanamide (PubChem CID 55970686) has the molecular formula C21H23F3N4O3 and a molecular weight of 436.43 g/mol. Its IUPAC name is 4-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]-N-[2-[[3-(trifluoromethyl)-2-pyridinyl]amino]ethyl]butanamide.
| Compound Name | 4-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]-N-[2-[[3-(trifluoromethyl)-2-pyridinyl]amino]ethyl]butanamide |
|---|---|
| PubChem CID | 55970686 |
| Molecular Formula | C21H23F3N4O3 |
| Molecular Weight | 436.43 g/mol |
| Exact Mass | 436.17 |
| IUPAC Name | 4-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]-N-[2-[[3-(trifluoromethyl)-2-pyridinyl]amino]ethyl]butanamide |
| SMILES | O=C(CCCOc1ccc2c(c1)CCC(=O)N2)NCCNc1ncccc1C(F)(F)F |
| InChI | InChI=1S/C21H23F3N4O3/c22-21(23,24)16-3-1-9-26-20(16)27-11-10-25-18(29)4-2-12-31-15-6-7-17-14(13-15)5-8-19(30)28-17/h1,3,6-7,9,13H,2,4-5,8,10-12H2,(H,25,29)(H,26,27)(H,28,30) |
| InChIKey | HSJXHSABYZQZII-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 92.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.43 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|