C20H25N5O2 — CID 133297263
6-[2-[(6-piperidin-1-ylpyrimidin-4-yl)amino]ethoxy]-3,4-dihydro-1H-quinolin-2-one (PubChem CID 133297263) has the molecular formula C20H25N5O2 and a molecular weight of 367.45 g/mol. Its IUPAC name is 6-[2-[(6-piperidin-1-ylpyrimidin-4-yl)amino]ethoxy]-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | 6-[2-[(6-piperidin-1-ylpyrimidin-4-yl)amino]ethoxy]-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 133297263 |
| Molecular Formula | C20H25N5O2 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.20 |
| IUPAC Name | 6-[2-[(6-piperidin-1-ylpyrimidin-4-yl)amino]ethoxy]-3,4-dihydro-1H-quinolin-2-one |
| SMILES | O=C1CCc2cc(OCCNc3cc(N4CCCCC4)ncn3)ccc2N1 |
| InChI | InChI=1S/C20H25N5O2/c26-20-7-4-15-12-16(5-6-17(15)24-20)27-11-8-21-18-13-19(23-14-22-18)25-9-2-1-3-10-25/h5-6,12-14H,1-4,7-11H2,(H,24,26)(H,21,22,23) |
| InChIKey | KAWHZVSTSRXVKX-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|