C17H20F2N4O — CID 133291658
N-[2-(2,4-difluorophenoxy)ethyl]-6-piperidin-1-ylpyrimidin-4-amine (PubChem CID 133291658) has the molecular formula C17H20F2N4O and a molecular weight of 334.37 g/mol. Its IUPAC name is N-[2-(2,4-difluorophenoxy)ethyl]-6-piperidin-1-ylpyrimidin-4-amine.
| Compound Name | N-[2-(2,4-difluorophenoxy)ethyl]-6-piperidin-1-ylpyrimidin-4-amine |
|---|---|
| PubChem CID | 133291658 |
| Molecular Formula | C17H20F2N4O |
| Molecular Weight | 334.37 g/mol |
| Exact Mass | 334.16 |
| IUPAC Name | N-[2-(2,4-difluorophenoxy)ethyl]-6-piperidin-1-ylpyrimidin-4-amine |
| SMILES | Fc1ccc(OCCNc2cc(N3CCCCC3)ncn2)c(F)c1 |
| InChI | InChI=1S/C17H20F2N4O/c18-13-4-5-15(14(19)10-13)24-9-6-20-16-11-17(22-12-21-16)23-7-2-1-3-8-23/h4-5,10-12H,1-3,6-9H2,(H,20,21,22) |
| InChIKey | MRSCVZSWRYLBHG-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.37 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|