C18H24N4O2 — CID 95613898
6-[2-[[(2R,3S)-3-pyrazol-1-ylbutan-2-yl]amino]ethoxy]-3,4-dihydro-1H-quinolin-2-one (PubChem CID 95613898) has the molecular formula C18H24N4O2 and a molecular weight of 328.42 g/mol. Its IUPAC name is 6-[2-[[(2R,3S)-3-pyrazol-1-ylbutan-2-yl]amino]ethoxy]-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | 6-[2-[[(2R,3S)-3-pyrazol-1-ylbutan-2-yl]amino]ethoxy]-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 95613898 |
| Molecular Formula | C18H24N4O2 |
| Molecular Weight | 328.42 g/mol |
| Exact Mass | 328.19 |
| IUPAC Name | 6-[2-[[(2R,3S)-3-pyrazol-1-ylbutan-2-yl]amino]ethoxy]-3,4-dihydro-1H-quinolin-2-one |
| SMILES | C[C@@H](NCCOc1ccc2c(c1)CCC(=O)N2)[C@H](C)n1cccn1 |
| InChI | InChI=1S/C18H24N4O2/c1-13(14(2)22-10-3-8-20-22)19-9-11-24-16-5-6-17-15(12-16)4-7-18(23)21-17/h3,5-6,8,10,12-14,19H,4,7,9,11H2,1-2H3,(H,21,23)/t13-,14+/m1/s1 |
| InChIKey | CVUGFIGWWRWBQQ-KGLIPLIRSA-N |
| XLogP | 2.39 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.42 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|