C19H20N4O2 — CID 133396864
2,6-dimethyl-4-[2-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]ethylamino]pyridine-3-carbonitrile (PubChem CID 133396864) has the molecular formula C19H20N4O2 and a molecular weight of 336.40 g/mol. Its IUPAC name is 2,6-dimethyl-4-[2-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]ethylamino]pyridine-3-carbonitrile.
| Compound Name | 2,6-dimethyl-4-[2-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]ethylamino]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 133396864 |
| Molecular Formula | C19H20N4O2 |
| Molecular Weight | 336.40 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | 2,6-dimethyl-4-[2-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]ethylamino]pyridine-3-carbonitrile |
| SMILES | Cc1cc(NCCOc2ccc3c(c2)CCC(=O)N3)c(C#N)c(C)n1 |
| InChI | InChI=1S/C19H20N4O2/c1-12-9-18(16(11-20)13(2)22-12)21-7-8-25-15-4-5-17-14(10-15)3-6-19(24)23-17/h4-5,9-10H,3,6-8H2,1-2H3,(H,21,22)(H,23,24) |
| InChIKey | NNXLGCZBBACQCZ-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 87.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.40 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|