C20H18ClN3O2 — CID 78897900
6-[2-[(7-chloroquinolin-4-yl)amino]ethoxy]-3,4-dihydro-1H-quinolin-2-one (PubChem CID 78897900) has the molecular formula C20H18ClN3O2 and a molecular weight of 367.84 g/mol. Its IUPAC name is 6-[2-[(7-chloroquinolin-4-yl)amino]ethoxy]-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | 6-[2-[(7-chloroquinolin-4-yl)amino]ethoxy]-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 78897900 |
| Molecular Formula | C20H18ClN3O2 |
| Molecular Weight | 367.84 g/mol |
| Exact Mass | 367.11 |
| IUPAC Name | 6-[2-[(7-chloroquinolin-4-yl)amino]ethoxy]-3,4-dihydro-1H-quinolin-2-one |
| SMILES | O=C1CCc2cc(OCCNc3ccnc4cc(Cl)ccc34)ccc2N1 |
| InChI | InChI=1S/C20H18ClN3O2/c21-14-2-4-16-18(7-8-22-19(16)12-14)23-9-10-26-15-3-5-17-13(11-15)1-6-20(25)24-17/h2-5,7-8,11-12H,1,6,9-10H2,(H,22,23)(H,24,25) |
| InChIKey | QVLUGCVUIZQGED-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.84 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|