C20H18Cl2N2O3 — CID 78891903
(E)-3-(2,5-dichlorophenyl)-N-[2-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]ethyl]prop-2-enamide (PubChem CID 78891903) has the molecular formula C20H18Cl2N2O3 and a molecular weight of 405.28 g/mol. Its IUPAC name is (E)-3-(2,5-dichlorophenyl)-N-[2-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]ethyl]prop-2-enamide.
| Compound Name | (E)-3-(2,5-dichlorophenyl)-N-[2-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 78891903 |
| Molecular Formula | C20H18Cl2N2O3 |
| Molecular Weight | 405.28 g/mol |
| Exact Mass | 404.07 |
| IUPAC Name | (E)-3-(2,5-dichlorophenyl)-N-[2-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]ethyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1cc(Cl)ccc1Cl)NCCOc1ccc2c(c1)CCC(=O)N2 |
| InChI | InChI=1S/C20H18Cl2N2O3/c21-15-3-5-17(22)13(11-15)1-7-19(25)23-9-10-27-16-4-6-18-14(12-16)2-8-20(26)24-18/h1,3-7,11-12H,2,8-10H2,(H,23,25)(H,24,26)/b7-1+ |
| InChIKey | ZPKFTSHZKLPOSJ-LREOWRDNSA-N |
| XLogP | 4.09 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.28 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|