C20H22N2O6 — CID 119226895
2-methyl-5-[[4-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]butanoylamino]methyl]furan-3-carboxylic acid (PubChem CID 119226895) has the molecular formula C20H22N2O6 and a molecular weight of 386.40 g/mol. Its IUPAC name is 2-methyl-5-[[4-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]butanoylamino]methyl]furan-3-carboxylic acid.
| Compound Name | 2-methyl-5-[[4-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]butanoylamino]methyl]furan-3-carboxylic acid |
|---|---|
| PubChem CID | 119226895 |
| Molecular Formula | C20H22N2O6 |
| Molecular Weight | 386.40 g/mol |
| Exact Mass | 386.15 |
| IUPAC Name | 2-methyl-5-[[4-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]butanoylamino]methyl]furan-3-carboxylic acid |
| SMILES | Cc1oc(CNC(=O)CCCOc2ccc3c(c2)CCC(=O)N3)cc1C(=O)O |
| InChI | InChI=1S/C20H22N2O6/c1-12-16(20(25)26)10-15(28-12)11-21-18(23)3-2-8-27-14-5-6-17-13(9-14)4-7-19(24)22-17/h5-6,9-10H,2-4,7-8,11H2,1H3,(H,21,23)(H,22,24)(H,25,26) |
| InChIKey | HJORCZAZMVLXET-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 117.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.40 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|