C22H22F2N2O5 — CID 97247312
methyl (2R)-2-(2,4-difluorophenyl)-2-[4-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]butanoylamino]acetate (PubChem CID 97247312) has the molecular formula C22H22F2N2O5 and a molecular weight of 432.42 g/mol. Its IUPAC name is methyl (2R)-2-(2,4-difluorophenyl)-2-[4-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]butanoylamino]acetate.
| Compound Name | methyl (2R)-2-(2,4-difluorophenyl)-2-[4-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]butanoylamino]acetate |
|---|---|
| PubChem CID | 97247312 |
| Molecular Formula | C22H22F2N2O5 |
| Molecular Weight | 432.42 g/mol |
| Exact Mass | 432.15 |
| IUPAC Name | methyl (2R)-2-(2,4-difluorophenyl)-2-[4-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]butanoylamino]acetate |
| SMILES | COC(=O)[C@H](NC(=O)CCCOc1ccc2c(c1)CCC(=O)N2)c1ccc(F)cc1F |
| InChI | InChI=1S/C22H22F2N2O5/c1-30-22(29)21(16-7-5-14(23)12-17(16)24)26-19(27)3-2-10-31-15-6-8-18-13(11-15)4-9-20(28)25-18/h5-8,11-12,21H,2-4,9-10H2,1H3,(H,25,28)(H,26,27)/t21-/m1/s1 |
| InChIKey | HUVGSUOFASSXAN-OAQYLSRUSA-N |
| XLogP | 3.04 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.42 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|