C28H38N4O3 — CID 55677179
N-[4-[4-(3-methylphenyl)piperazin-1-yl]butan-2-yl]-4-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]butanamide (PubChem CID 55677179) has the molecular formula C28H38N4O3 and a molecular weight of 478.64 g/mol. Its IUPAC name is N-[4-[4-(3-methylphenyl)piperazin-1-yl]butan-2-yl]-4-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]butanamide.
| Compound Name | N-[4-[4-(3-methylphenyl)piperazin-1-yl]butan-2-yl]-4-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]butanamide |
|---|---|
| PubChem CID | 55677179 |
| Molecular Formula | C28H38N4O3 |
| Molecular Weight | 478.64 g/mol |
| Exact Mass | 478.29 |
| IUPAC Name | N-[4-[4-(3-methylphenyl)piperazin-1-yl]butan-2-yl]-4-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]butanamide |
| SMILES | Cc1cccc(N2CCN(CCC(C)NC(=O)CCCOc3ccc4c(c3)CCC(=O)N4)CC2)c1 |
| InChI | InChI=1S/C28H38N4O3/c1-21-5-3-6-24(19-21)32-16-14-31(15-17-32)13-12-22(2)29-27(33)7-4-18-35-25-9-10-26-23(20-25)8-11-28(34)30-26/h3,5-6,9-10,19-20,22H,4,7-8,11-18H2,1-2H3,(H,29,33)(H,30,34) |
| InChIKey | WIRXFAWUBQZJAD-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.64 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|