C22H33N3O5 — CID 55673887
ethyl N-[4-methyl-1-[4-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]butanoylamino]pentan-2-yl]carbamate (PubChem CID 55673887) has the molecular formula C22H33N3O5 and a molecular weight of 419.52 g/mol. Its IUPAC name is ethyl N-[4-methyl-1-[4-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]butanoylamino]pentan-2-yl]carbamate.
| Compound Name | ethyl N-[4-methyl-1-[4-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]butanoylamino]pentan-2-yl]carbamate |
|---|---|
| PubChem CID | 55673887 |
| Molecular Formula | C22H33N3O5 |
| Molecular Weight | 419.52 g/mol |
| Exact Mass | 419.24 |
| IUPAC Name | ethyl N-[4-methyl-1-[4-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]butanoylamino]pentan-2-yl]carbamate |
| SMILES | CCOC(=O)NC(CNC(=O)CCCOc1ccc2c(c1)CCC(=O)N2)CC(C)C |
| InChI | InChI=1S/C22H33N3O5/c1-4-29-22(28)24-17(12-15(2)3)14-23-20(26)6-5-11-30-18-8-9-19-16(13-18)7-10-21(27)25-19/h8-9,13,15,17H,4-7,10-12,14H2,1-3H3,(H,23,26)(H,24,28)(H,25,27) |
| InChIKey | FNCBAKKINJMPCR-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.52 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|