About 5-[[(1S)-1-hydroxy-2,3-dihydro-1H-inden-5-yl]oxymethyl]pyrrolidin-2-one
5-[[(1S)-1-hydroxy-2,3-dihydro-1H-inden-5-yl]oxymethyl]pyrrolidin-2-one (PubChem CID 114281692) has the molecular formula C14H17NO3
and a molecular weight of 247.29 g/mol. Its IUPAC name is 5-[[(1S)-1-hydroxy-2,3-dihydro-1H-inden-5-yl]oxymethyl]pyrrolidin-2-one.
Molecular Properties
| Compound Name | 5-[[(1S)-1-hydroxy-2,3-dihydro-1H-inden-5-yl]oxymethyl]pyrrolidin-2-one |
| PubChem CID | 114281692 |
| Molecular Formula | C14H17NO3 |
| Molecular Weight | 247.29 g/mol |
| Exact Mass | 247.12 |
| IUPAC Name | 5-[[(1S)-1-hydroxy-2,3-dihydro-1H-inden-5-yl]oxymethyl]pyrrolidin-2-one |
| SMILES | O=C1CCC(COc2ccc3c(c2)CC[C@@H]3O)N1 |
| InChI | InChI=1S/C14H17NO3/c16-13-5-1-9-7-11(3-4-12(9)13)18-8-10-2-6-14(17)15-10/h3-4,7,10,13,16H,1-2,5-6,8H2,(H,15,17)/t10?,13-/m0/s1 |
| InChIKey | OKYPOBZYEDVXEQ-HQVZTVAUSA-N |
| XLogP | 1.32 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.29 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-[[(1S)-1-hydroxy-2,3-dihydro-1H-inden-5-yl]oxymethyl]pyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[[(1S)-1-hydroxy-2,3-dihydro-1H-inden-5-yl]oxymethyl]pyrrolidin-2-one?
The IUPAC name of 5-[[(1S)-1-hydroxy-2,3-dihydro-1H-inden-5-yl]oxymethyl]pyrrolidin-2-one (CID 114281692) is 5-[[(1S)-1-hydroxy-2,3-dihydro-1H-inden-5-yl]oxymethyl]pyrrolidin-2-one.
What is the SMILES notation for 5-[[(1S)-1-hydroxy-2,3-dihydro-1H-inden-5-yl]oxymethyl]pyrrolidin-2-one?
The canonical SMILES for 5-[[(1S)-1-hydroxy-2,3-dihydro-1H-inden-5-yl]oxymethyl]pyrrolidin-2-one is O=C1CCC(COc2ccc3c(c2)CC[C@@H]3O)N1.
What is the InChIKey of 5-[[(1S)-1-hydroxy-2,3-dihydro-1H-inden-5-yl]oxymethyl]pyrrolidin-2-one?
The InChIKey is OKYPOBZYEDVXEQ-HQVZTVAUSA-N. The full InChI is InChI=1S/C14H17NO3/c16-13-5-1-9-7-11(3-4-12(9)13)18-8-10-2-6-14(17)15-10/h3-4,7,10,13,16H,1-2,5-6,8H2,(H,15,17)/t10?,13-/m0/s1.
What are the key properties of 5-[[(1S)-1-hydroxy-2,3-dihydro-1H-inden-5-yl]oxymethyl]pyrrolidin-2-one?
5-[[(1S)-1-hydroxy-2,3-dihydro-1H-inden-5-yl]oxymethyl]pyrrolidin-2-one has a molecular weight of 247.29 g/mol, XLogP of 1.32, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[[(1S)-1-hydroxy-2,3-dihydro-1H-inden-5-yl]oxymethyl]pyrrolidin-2-one is sourced from PubChem (CID 114281692), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).