C16H23NO4 — CID 107684834
2-[(1-hydroxy-2,3-dihydro-1H-inden-5-yl)oxy]-N-(3-methoxypropyl)propanamide (PubChem CID 107684834) has the molecular formula C16H23NO4 and a molecular weight of 293.36 g/mol. Its IUPAC name is 2-[(1-hydroxy-2,3-dihydro-1H-inden-5-yl)oxy]-N-(3-methoxypropyl)propanamide.
| Compound Name | 2-[(1-hydroxy-2,3-dihydro-1H-inden-5-yl)oxy]-N-(3-methoxypropyl)propanamide |
|---|---|
| PubChem CID | 107684834 |
| Molecular Formula | C16H23NO4 |
| Molecular Weight | 293.36 g/mol |
| Exact Mass | 293.16 |
| IUPAC Name | 2-[(1-hydroxy-2,3-dihydro-1H-inden-5-yl)oxy]-N-(3-methoxypropyl)propanamide |
| SMILES | COCCCNC(=O)C(C)Oc1ccc2c(c1)CCC2O |
| InChI | InChI=1S/C16H23NO4/c1-11(16(19)17-8-3-9-20-2)21-13-5-6-14-12(10-13)4-7-15(14)18/h5-6,10-11,15,18H,3-4,7-9H2,1-2H3,(H,17,19) |
| InChIKey | MTAMQOSAONEORQ-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.36 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|