C17H18O3 — CID 107684824
5-(2-hydroxy-2-phenylethoxy)-2,3-dihydro-1H-inden-1-ol (PubChem CID 107684824) has the molecular formula C17H18O3 and a molecular weight of 270.33 g/mol. Its IUPAC name is 5-(2-hydroxy-2-phenylethoxy)-2,3-dihydro-1H-inden-1-ol.
| Compound Name | 5-(2-hydroxy-2-phenylethoxy)-2,3-dihydro-1H-inden-1-ol |
|---|---|
| PubChem CID | 107684824 |
| Molecular Formula | C17H18O3 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.13 |
| IUPAC Name | 5-(2-hydroxy-2-phenylethoxy)-2,3-dihydro-1H-inden-1-ol |
| SMILES | OC(COc1ccc2c(c1)CCC2O)c1ccccc1 |
| InChI | InChI=1S/C17H18O3/c18-16-9-6-13-10-14(7-8-15(13)16)20-11-17(19)12-4-2-1-3-5-12/h1-5,7-8,10,16-19H,6,9,11H2 |
| InChIKey | GSARLOXMLCPVQT-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |