C21H33NO2 — CID 70863293
2-amino-3-(6-heptoxy-1,4-dihydronaphthalen-1-yl)-2-methylpropan-1-ol (PubChem CID 70863293) has the molecular formula C21H33NO2 and a molecular weight of 331.50 g/mol. Its IUPAC name is 2-amino-3-(6-heptoxy-1,4-dihydronaphthalen-1-yl)-2-methylpropan-1-ol.
| Compound Name | 2-amino-3-(6-heptoxy-1,4-dihydronaphthalen-1-yl)-2-methylpropan-1-ol |
|---|---|
| PubChem CID | 70863293 |
| Molecular Formula | C21H33NO2 |
| Molecular Weight | 331.50 g/mol |
| Exact Mass | 331.25 |
| IUPAC Name | 2-amino-3-(6-heptoxy-1,4-dihydronaphthalen-1-yl)-2-methylpropan-1-ol |
| SMILES | CCCCCCCOc1ccc2c(c1)CC=CC2CC(C)(N)CO |
| InChI | InChI=1S/C21H33NO2/c1-3-4-5-6-7-13-24-19-11-12-20-17(14-19)9-8-10-18(20)15-21(2,22)16-23/h8,10-12,14,18,23H,3-7,9,13,15-16,22H2,1-2H3 |
| InChIKey | VTYYZNJIEDQGQR-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.50 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|