C26H38ClNO3 — CID 70181681
(2S)-1-amino-1-(3-hexoxy-6,7,8,9-tetrahydro-5H-benzo[7]annulen-6-yl)-3-phenoxypropan-2-ol;hydrochloride (PubChem CID 70181681) has the molecular formula C26H38ClNO3 and a molecular weight of 448.05 g/mol. Its IUPAC name is (2S)-1-amino-1-(3-hexoxy-6,7,8,9-tetrahydro-5H-benzo[7]annulen-6-yl)-3-phenoxypropan-2-ol;hydrochloride.
| Compound Name | (2S)-1-amino-1-(3-hexoxy-6,7,8,9-tetrahydro-5H-benzo[7]annulen-6-yl)-3-phenoxypropan-2-ol;hydrochloride |
|---|---|
| PubChem CID | 70181681 |
| Molecular Formula | C26H38ClNO3 |
| Molecular Weight | 448.05 g/mol |
| Exact Mass | 447.25 |
| IUPAC Name | (2S)-1-amino-1-(3-hexoxy-6,7,8,9-tetrahydro-5H-benzo[7]annulen-6-yl)-3-phenoxypropan-2-ol;hydrochloride |
| SMILES | CCCCCCOc1ccc2c(c1)CC(C(N)[C@H](O)COc1ccccc1)CCC2.Cl |
| InChI | InChI=1S/C26H37NO3.ClH/c1-2-3-4-8-16-29-24-15-14-20-10-9-11-21(17-22(20)18-24)26(27)25(28)19-30-23-12-6-5-7-13-23;/h5-7,12-15,18,21,25-26,28H,2-4,8-11,16-17,19,27H2,1H3;1H/t21?,25-,26?;/m1./s1 |
| InChIKey | CUCQAGHBKMLVIR-MPCOCLLJSA-N |
| XLogP | 5.33 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.05 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|