C25H34ClN3O3 — CID 46873461
(3S)-7-amino-N-(4-hydroxy-2,3,5-trimethylphenyl)-2-(4-methylpentanoyl)-3,4-dihydro-1H-isoquinoline-3-carboxamide;hydrochloride (PubChem CID 46873461) has the molecular formula C25H34ClN3O3 and a molecular weight of 460.02 g/mol. Its IUPAC name is (3S)-7-amino-N-(4-hydroxy-2,3,5-trimethylphenyl)-2-(4-methylpentanoyl)-3,4-dihydro-1H-isoquinoline-3-carboxamide;hydrochloride.
| Compound Name | (3S)-7-amino-N-(4-hydroxy-2,3,5-trimethylphenyl)-2-(4-methylpentanoyl)-3,4-dihydro-1H-isoquinoline-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 46873461 |
| Molecular Formula | C25H34ClN3O3 |
| Molecular Weight | 460.02 g/mol |
| Exact Mass | 459.23 |
| IUPAC Name | (3S)-7-amino-N-(4-hydroxy-2,3,5-trimethylphenyl)-2-(4-methylpentanoyl)-3,4-dihydro-1H-isoquinoline-3-carboxamide;hydrochloride |
| SMILES | Cc1cc(NC(=O)[C@@H]2Cc3ccc(N)cc3CN2C(=O)CCC(C)C)c(C)c(C)c1O.Cl |
| InChI | InChI=1S/C25H33N3O3.ClH/c1-14(2)6-9-23(29)28-13-19-11-20(26)8-7-18(19)12-22(28)25(31)27-21-10-15(3)24(30)17(5)16(21)4;/h7-8,10-11,14,22,30H,6,9,12-13,26H2,1-5H3,(H,27,31);1H/t22-;/m0./s1 |
| InChIKey | XAKDRYHPQCSTFZ-FTBISJDPSA-N |
| XLogP | 4.65 |
| TPSA | 95.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.02 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|