C22H31N3O6 — CID 15941810
(2S)-2-[[1-[8-(hydroxyamino)-8-oxooctanoyl]pyrrolidine-2-carbonyl]amino]-3-phenylpropanoic acid (PubChem CID 15941810) has the molecular formula C22H31N3O6 and a molecular weight of 433.51 g/mol. Its IUPAC name is (2S)-2-[[1-[8-(hydroxyamino)-8-oxooctanoyl]pyrrolidine-2-carbonyl]amino]-3-phenylpropanoic acid.
| Compound Name | (2S)-2-[[1-[8-(hydroxyamino)-8-oxooctanoyl]pyrrolidine-2-carbonyl]amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 15941810 |
| Molecular Formula | C22H31N3O6 |
| Molecular Weight | 433.51 g/mol |
| Exact Mass | 433.22 |
| IUPAC Name | (2S)-2-[[1-[8-(hydroxyamino)-8-oxooctanoyl]pyrrolidine-2-carbonyl]amino]-3-phenylpropanoic acid |
| SMILES | O=C(CCCCCCC(=O)N1CCCC1C(=O)N[C@@H](Cc1ccccc1)C(=O)O)NO |
| InChI | InChI=1S/C22H31N3O6/c26-19(24-31)12-6-1-2-7-13-20(27)25-14-8-11-18(25)21(28)23-17(22(29)30)15-16-9-4-3-5-10-16/h3-5,9-10,17-18,31H,1-2,6-8,11-15H2,(H,23,28)(H,24,26)(H,29,30)/t17-,18?/m0/s1 |
| InChIKey | ABSOKYGDGUCJSX-ZENAZSQFSA-N |
| XLogP | 1.64 |
| TPSA | 136.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.51 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|