C25H21N2O4- — CID 141404371
benzyl 2-hydroxy-5-(2-oxido-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl)benzoate (PubChem CID 141404371) has the molecular formula C25H21N2O4- and a molecular weight of 413.45 g/mol. Its IUPAC name is benzyl 2-hydroxy-5-(2-oxido-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl)benzoate.
| Compound Name | benzyl 2-hydroxy-5-(2-oxido-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl)benzoate |
|---|---|
| PubChem CID | 141404371 |
| Molecular Formula | C25H21N2O4- |
| Molecular Weight | 413.45 g/mol |
| Exact Mass | 413.15 |
| IUPAC Name | benzyl 2-hydroxy-5-(2-oxido-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl)benzoate |
| SMILES | O=C(OCc1ccccc1)c1cc(C2c3[nH]c4ccccc4c3CCN2[O-])ccc1O |
| InChI | InChI=1S/C25H21N2O4/c28-22-11-10-17(14-20(22)25(29)31-15-16-6-2-1-3-7-16)24-23-19(12-13-27(24)30)18-8-4-5-9-21(18)26-23/h1-11,14,24,26,28H,12-13,15H2/q-1 |
| InChIKey | BHVPJTUYPFFILV-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 88.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.45 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|