C30H42N2O3 — CID 145393586
methane;methanol;1-(2-phenylmethoxy-11,21-diazatetracyclo[12.7.0.04,9.015,20]henicosa-1(14),15,17,19-tetraen-11-yl)ethanone (PubChem CID 145393586) has the molecular formula C30H42N2O3 and a molecular weight of 478.68 g/mol. Its IUPAC name is methane;methanol;1-(2-phenylmethoxy-11,21-diazatetracyclo[12.7.0.04,9.015,20]henicosa-1(14),15,17,19-tetraen-11-yl)ethanone.
| Compound Name | methane;methanol;1-(2-phenylmethoxy-11,21-diazatetracyclo[12.7.0.04,9.015,20]henicosa-1(14),15,17,19-tetraen-11-yl)ethanone |
|---|---|
| PubChem CID | 145393586 |
| Molecular Formula | C30H42N2O3 |
| Molecular Weight | 478.68 g/mol |
| Exact Mass | 478.32 |
| IUPAC Name | methane;methanol;1-(2-phenylmethoxy-11,21-diazatetracyclo[12.7.0.04,9.015,20]henicosa-1(14),15,17,19-tetraen-11-yl)ethanone |
| SMILES | C.CC(=O)N1CCc2c([nH]c3ccccc23)C(OCc2ccccc2)CC2CCCCC2C1.CO |
| InChI | InChI=1S/C28H34N2O2.CH4O.CH4/c1-20(31)30-16-15-25-24-13-7-8-14-26(24)29-28(25)27(32-19-21-9-3-2-4-10-21)17-22-11-5-6-12-23(22)18-30;1-2;/h2-4,7-10,13-14,22-23,27,29H,5-6,11-12,15-19H2,1H3;2H,1H3;1H4 |
| InChIKey | OJZPOJCGMBDFNW-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 65.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.68 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |