C28H33N3O4 — CID 18654361
tert-butyl (2S,4R)-4-phenylmethoxy-2-(1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carbonyl)pyrrolidine-1-carboxylate (PubChem CID 18654361) has the molecular formula C28H33N3O4 and a molecular weight of 475.59 g/mol. Its IUPAC name is tert-butyl (2S,4R)-4-phenylmethoxy-2-(1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carbonyl)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S,4R)-4-phenylmethoxy-2-(1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carbonyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 18654361 |
| Molecular Formula | C28H33N3O4 |
| Molecular Weight | 475.59 g/mol |
| Exact Mass | 475.25 |
| IUPAC Name | tert-butyl (2S,4R)-4-phenylmethoxy-2-(1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carbonyl)pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@H](OCc2ccccc2)C[C@H]1C(=O)N1CCc2c([nH]c3ccccc23)C1 |
| InChI | InChI=1S/C28H33N3O4/c1-28(2,3)35-27(33)31-16-20(34-18-19-9-5-4-6-10-19)15-25(31)26(32)30-14-13-22-21-11-7-8-12-23(21)29-24(22)17-30/h4-12,20,25,29H,13-18H2,1-3H3/t20-,25+/m1/s1 |
| InChIKey | QRKVEXZJCGJHMD-NLFFAJNJSA-N |
| XLogP | 4.65 |
| TPSA | 74.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.59 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|