C37H44N4O2 — CID 19789764
benzyl 7-(1-ethyl-2,9-dimethyl-3,4,4a,9a-tetrahydro-1H-pyrido[3,4-b]indol-6-yl)-2,4,5,6,7,8-hexahydro-1H-azonino[5,4-b]indole-3-carboxylate (PubChem CID 19789764) has the molecular formula C37H44N4O2 and a molecular weight of 576.79 g/mol. Its IUPAC name is benzyl 7-(1-ethyl-2,9-dimethyl-3,4,4a,9a-tetrahydro-1H-pyrido[3,4-b]indol-6-yl)-2,4,5,6,7,8-hexahydro-1H-azonino[5,4-b]indole-3-carboxylate.
| Compound Name | benzyl 7-(1-ethyl-2,9-dimethyl-3,4,4a,9a-tetrahydro-1H-pyrido[3,4-b]indol-6-yl)-2,4,5,6,7,8-hexahydro-1H-azonino[5,4-b]indole-3-carboxylate |
|---|---|
| PubChem CID | 19789764 |
| Molecular Formula | C37H44N4O2 |
| Molecular Weight | 576.79 g/mol |
| Exact Mass | 576.35 |
| IUPAC Name | benzyl 7-(1-ethyl-2,9-dimethyl-3,4,4a,9a-tetrahydro-1H-pyrido[3,4-b]indol-6-yl)-2,4,5,6,7,8-hexahydro-1H-azonino[5,4-b]indole-3-carboxylate |
| SMILES | CCC1C2C(CCN1C)c1cc(C3CCCN(C(=O)OCc4ccccc4)CCc4c3[nH]c3ccccc43)ccc1N2C |
| InChI | InChI=1S/C37H44N4O2/c1-4-33-36-30(18-21-39(33)2)31-23-26(16-17-34(31)40(36)3)27-14-10-20-41(37(42)43-24-25-11-6-5-7-12-25)22-19-29-28-13-8-9-15-32(28)38-35(27)29/h5-9,11-13,15-17,23,27,30,33,36,38H,4,10,14,18-22,24H2,1-3H3 |
| InChIKey | VVEXGXCDDOVMRV-UHFFFAOYSA-N |
| XLogP | 7.29 |
| TPSA | 51.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.79 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |