C34H32N2O3 — CID 53306459
benzyl 6-ethyl-1-(3-phenylmethoxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate (PubChem CID 53306459) has the molecular formula C34H32N2O3 and a molecular weight of 516.64 g/mol. Its IUPAC name is benzyl 6-ethyl-1-(3-phenylmethoxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate.
| Compound Name | benzyl 6-ethyl-1-(3-phenylmethoxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate |
|---|---|
| PubChem CID | 53306459 |
| Molecular Formula | C34H32N2O3 |
| Molecular Weight | 516.64 g/mol |
| Exact Mass | 516.24 |
| IUPAC Name | benzyl 6-ethyl-1-(3-phenylmethoxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate |
| SMILES | CCc1ccc2[nH]c3c(c2c1)CCN(C(=O)OCc1ccccc1)C3c1cccc(OCc2ccccc2)c1 |
| InChI | InChI=1S/C34H32N2O3/c1-2-24-16-17-31-30(20-24)29-18-19-36(34(37)39-23-26-12-7-4-8-13-26)33(32(29)35-31)27-14-9-15-28(21-27)38-22-25-10-5-3-6-11-25/h3-17,20-21,33,35H,2,18-19,22-23H2,1H3 |
| InChIKey | MXDQLUFWVBAOHI-UHFFFAOYSA-N |
| XLogP | 7.59 |
| TPSA | 54.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.64 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|